CAS 1220021-36-2

2-Piperidineethanol, 2-propanoate, hydrochloride (1:1)

Description:

2-Piperidineethanol, 2-propanoate, hydrochloride (1:1) is a chemical compound characterized by its piperidine and ethanolamine structure, which contributes to its potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in pharmaceutical applications. This compound may exhibit properties such as being a potential intermediate in organic synthesis or a candidate for drug development due to its structural features that can interact with biological targets. Its molecular structure includes a piperidine ring, which is a six-membered nitrogen-containing heterocycle, and an ethanol moiety, suggesting possible interactions with neurotransmitter systems. The presence of the propanoate group may influence its pharmacokinetic properties, such as absorption and distribution. Safety and handling precautions should be observed, as with any chemical, particularly in laboratory settings. Further studies would be necessary to fully elucidate its biological effects and potential therapeutic applications.

Formula: C₁₀H₁₉NO₂·ClH

InChI: InChI=1S/C10H19NO2.ClH/c1-2-10(12)13-8-6-9-5-3-4-7-11-9;/h9,11H,2-8H2,1H3;1H

InChI key: InChIKey=KYPCMKOHADLXEZ-UHFFFAOYSA-N

SMILES: C(COC(CC)=O)C1CCCCN1.Cl

Synonyms:

• 2-Piperidineethanol, 2-propanoate, hydrochloride (1:1)