CymitQuimica logo

CAS 1220021-39-5

:

3-[2-Chloro-4-(1,1-dimethylpropyl)phenoxy]azetidine

Description:
3-[2-Chloro-4-(1,1-dimethylpropyl)phenoxy]azetidine, identified by its CAS number 1220021-39-5, is a chemical compound characterized by its azetidine ring structure, which is a four-membered saturated heterocycle containing one nitrogen atom. This compound features a phenoxy group substituted with a chlorine atom and a bulky 1,1-dimethylpropyl group, contributing to its unique chemical properties. The presence of the chlorine atom enhances its reactivity and potential biological activity, while the bulky substituent may influence its steric properties and solubility. The azetidine moiety can participate in various chemical reactions, making this compound of interest in medicinal chemistry and synthetic applications. Its specific characteristics, such as melting point, boiling point, and solubility, would depend on the molecular interactions and the environment in which it is studied. Overall, this compound's structure suggests potential applications in pharmaceuticals or agrochemicals, warranting further investigation into its biological activity and chemical behavior.
Formula:C14H20ClNO
InChI:InChI=1S/C14H20ClNO/c1-4-14(2,3)10-5-6-13(12(15)7-10)17-11-8-16-9-11/h5-7,11,16H,4,8-9H2,1-3H3
InChI key:InChIKey=KYCBHDNVJWZBSU-UHFFFAOYSA-N
SMILES:C(CC)(C)(C)C1=CC(Cl)=C(OC2CNC2)C=C1
Synonyms:
  • 3-[2-Chloro-4-(1,1-dimethylpropyl)phenoxy]azetidine
  • Azetidine, 3-[2-chloro-4-(1,1-dimethylpropyl)phenoxy]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.