CAS 1220021-42-0

3-Azetidinyl cyclopentanecarboxylate

Description:

3-Azetidinyl cyclopentanecarboxylate is a chemical compound characterized by its unique structural features, which include a cyclopentanecarboxylate moiety and an azetidine ring. The azetidine ring, a four-membered nitrogen-containing heterocycle, contributes to the compound's potential biological activity and reactivity. The cyclopentanecarboxylate part of the molecule provides a carboxylate functional group, which can participate in various chemical reactions, including esterification and nucleophilic substitution. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its molecular structure suggests potential applications in drug development, particularly in the design of compounds targeting specific biological pathways. Additionally, the presence of both cyclic and acyclic components in its structure may influence its physical properties, such as solubility and stability. As with many organic compounds, the specific characteristics, including melting point, boiling point, and reactivity, would depend on the precise molecular interactions and the environment in which the compound is studied.

Formula: C₉H₁₅NO₂

InChI: InChI=1S/C9H15NO2/c11-9(7-3-1-2-4-7)12-8-5-10-6-8/h7-8,10H,1-6H2

InChI key: InChIKey=VEAXGKRNRSXBSC-UHFFFAOYSA-N

SMILES: C(OC1CNC1)(=O)C2CCCC2

Synonyms:

• Cyclopentanecarboxylic acid, 3-azetidinyl ester
• 3-Azetidinyl cyclopentanecarboxylate