CAS 1220021-44-2

2-Piperidineethanamine, N,N-di-2-propen-1-yl-, hydrochloride (1:2)

Description:

2-Piperidineethanamine, N,N-di-2-propen-1-yl-, hydrochloride (1:2) is a chemical compound characterized by its piperidine and propenyl functional groups. As a hydrochloride salt, it is typically encountered in a solid form, which enhances its stability and solubility in water. The presence of the piperidine ring contributes to its basicity and potential biological activity, making it of interest in medicinal chemistry. The propenyl substituents may impart unique reactivity and steric properties, influencing its interactions with biological targets. This compound may exhibit various pharmacological effects, although specific activities would depend on its structural conformation and the presence of other functional groups. Safety data and handling precautions are essential, as with any chemical, particularly those with potential biological activity. Proper storage conditions should be maintained to prevent degradation. Overall, this compound's unique structure suggests potential applications in drug development and synthesis, warranting further investigation into its properties and effects.

Formula: C₁₃H₂₄N₂·2ClH

InChI: InChI=1S/C13H24N2.2ClH/c1-3-10-15(11-4-2)12-8-13-7-5-6-9-14-13;;/h3-4,13-14H,1-2,5-12H2;2*1H

InChI key: InChIKey=HFELWCNWMVOSCJ-UHFFFAOYSA-N

SMILES: C(CN(CC=C)CC=C)C1CCCCN1.Cl

Synonyms:

• 2-Piperidineethanamine, N,N-di-2-propen-1-yl-, hydrochloride (1:2)