CAS 1220021-46-4

5-(2-Ethyl-1-piperidinyl)-2-(methylsulfonyl)benzenamine

Description:

5-(2-Ethyl-1-piperidinyl)-2-(methylsulfonyl)benzenamine, identified by its CAS number 1220021-46-4, is a chemical compound characterized by its unique structural features. It contains a piperidine ring, which contributes to its potential biological activity, and a methylsulfonyl group that enhances its solubility and reactivity. The presence of the ethyl substituent on the piperidine ring may influence its pharmacokinetic properties, such as absorption and distribution. This compound is likely to exhibit properties typical of amines, including basicity and the ability to form hydrogen bonds, which can affect its interactions with biological targets. Additionally, the sulfonyl group may impart specific reactivity, making it a candidate for various chemical transformations. While specific applications or biological activities may vary, compounds of this nature are often explored in medicinal chemistry for their potential therapeutic effects. As with any chemical substance, safety data and handling precautions should be considered when working with this compound.

Formula: C₁₄H₂₂N₂O₂S

InChI: InChI=1S/C14H22N2O2S/c1-3-11-6-4-5-9-16(11)12-7-8-14(13(15)10-12)19(2,17)18/h7-8,10-11H,3-6,9,15H2,1-2H3

InChI key: InChIKey=QISDNMCUWABZBW-UHFFFAOYSA-N

SMILES: C(C)C1N(CCCC1)C2=CC(N)=C(S(C)(=O)=O)C=C2

Synonyms:

• 5-(2-Ethyl-1-piperidinyl)-2-(methylsulfonyl)benzenamine
• Benzenamine, 5-(2-ethyl-1-piperidinyl)-2-(methylsulfonyl)-