CAS 1220021-48-6

2-Piperidinemethanamine, N-cyclohexyl-N-ethyl-, hydrochloride (1:2)

Description:

2-Piperidinemethanamine, N-cyclohexyl-N-ethyl-, hydrochloride (1:2) is a chemical compound characterized by its piperidine ring structure, which contributes to its basicity and potential for forming salts, such as the hydrochloride form. This compound features a cyclohexyl and ethyl substituent on the nitrogen atom of the piperidine, influencing its solubility and reactivity. As a hydrochloride salt, it is typically more stable and soluble in water compared to its free base form, making it suitable for various applications in pharmaceutical formulations. The presence of the piperidine moiety suggests potential biological activity, as piperidine derivatives are often explored for their pharmacological properties. Additionally, the compound's molecular structure may allow for interactions with biological targets, which could be relevant in medicinal chemistry. Safety and handling precautions should be observed, as with any chemical substance, particularly those with potential biological activity.

Formula: C₁₄H₂₈N₂·2ClH

InChI: InChI=1S/C14H28N2.2ClH/c1-2-16(14-9-4-3-5-10-14)12-13-8-6-7-11-15-13;;/h13-15H,2-12H2,1H3;2*1H

InChI key: InChIKey=RQTURBOCIRFPGA-UHFFFAOYSA-N

SMILES: N(CC1CCCCN1)(CC)C2CCCCC2.Cl

Synonyms:

• 2-Piperidinemethanamine, N-cyclohexyl-N-ethyl-, hydrochloride (1:2)