
CAS 1220021-51-1
:Piperidine, 4-[2-(2-methoxyethoxy)ethoxy]-, hydrochloride (1:1)
Description:
Piperidine, 4-[2-(2-methoxyethoxy)ethoxy]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring, which is a six-membered saturated heterocyclic amine. The presence of the 2-(2-methoxyethoxy)ethoxy substituent indicates that it has a branched ether functional group, contributing to its solubility and potential reactivity. As a hydrochloride salt, it is typically more stable and soluble in water compared to its free base form, making it suitable for various applications in pharmaceuticals and organic synthesis. The compound may exhibit properties such as basicity due to the nitrogen atom in the piperidine ring, and it may participate in hydrogen bonding due to the ether groups. Its molecular structure suggests potential uses in medicinal chemistry, particularly in the development of drugs targeting the central nervous system or other biological pathways. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity and reactivity.
Formula:C10H21NO3·ClH
InChI:InChI=1S/C10H21NO3.ClH/c1-12-6-7-13-8-9-14-10-2-4-11-5-3-10;/h10-11H,2-9H2,1H3;1H
InChI key:InChIKey=SGLZDLZFBKGGSB-UHFFFAOYSA-N
SMILES:O(CCOCCOC)C1CCNCC1.Cl
Synonyms:- 2-(2-Methoxyethoxy)ethyl 4-piperidinyl ether hydrochloride
- Piperidine, 4-[2-(2-methoxyethoxy)ethoxy]-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.