
CAS 1220021-60-2
:Piperidine, 4-(4-penten-1-yloxy)-, hydrochloride (1:1)
Description:
Piperidine, 4-(4-penten-1-yloxy)-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring, which is a six-membered saturated heterocycle containing one nitrogen atom. The presence of the 4-(4-penten-1-yloxy) substituent indicates that it has a pentenyl ether functional group, contributing to its reactivity and potential applications in organic synthesis. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which enhances its utility in various chemical processes. This compound may exhibit biological activity, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. Its properties, such as melting point, boiling point, and specific reactivity, would depend on the molecular interactions and the presence of functional groups. Safety data and handling precautions should be considered, as with any chemical substance, to ensure proper laboratory practices. Overall, this compound represents a versatile building block in organic synthesis and medicinal chemistry.
Formula:C10H19NO·ClH
InChI:InChI=1S/C10H19NO.ClH/c1-2-3-4-9-12-10-5-7-11-8-6-10;/h2,10-11H,1,3-9H2;1H
InChI key:InChIKey=FUUXVUZYAVEJNG-UHFFFAOYSA-N
SMILES:O(CCCC=C)C1CCNCC1.Cl
Synonyms:- Piperidine, 4-(4-penten-1-yloxy)-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.