CAS 1220021-65-7

1-[3-Amino-4-(ethylsulfonyl)phenyl]-3-pyrrolidinol

Description:

1-[3-Amino-4-(ethylsulfonyl)phenyl]-3-pyrrolidinol, identified by its CAS number 1220021-65-7, is a chemical compound that features a pyrrolidine ring and an amino-substituted phenyl group. This compound is characterized by the presence of an ethylsulfonyl group, which enhances its solubility and may influence its biological activity. The amino group on the phenyl ring can participate in hydrogen bonding and may contribute to the compound's reactivity and interaction with biological targets. The structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of functional groups that can engage in various chemical interactions. Additionally, the compound's properties, such as polarity, solubility, and stability, are influenced by its molecular structure, making it a candidate for further research in drug development and related fields. As with many organic compounds, its behavior in biological systems would depend on factors such as pH, temperature, and the presence of other chemical species.

Formula: C₁₂H₁₈N₂O₃S

InChI: InChI=1S/C12H18N2O3S/c1-2-18(16,17)12-4-3-9(7-11(12)13)14-6-5-10(15)8-14/h3-4,7,10,15H,2,5-6,8,13H2,1H3

InChI key: InChIKey=ODTNFKGHVBONJO-UHFFFAOYSA-N

SMILES: NC=1C=C(C=CC1S(CC)(=O)=O)N2CCC(O)C2

Synonyms:

• 1-[3-Amino-4-(ethylsulfonyl)phenyl]-3-pyrrolidinol
• 3-Pyrrolidinol, 1-[3-amino-4-(ethylsulfonyl)phenyl]-