CAS 1220027-01-9
:3-(2-Thienyl)-1H-indole-2-carboxylic acid
Description:
3-(2-Thienyl)-1H-indole-2-carboxylic acid is an organic compound characterized by its unique structure, which combines an indole moiety with a thienyl group. This compound features a carboxylic acid functional group, contributing to its acidic properties and potential reactivity. The presence of the thienyl ring, a five-membered aromatic heterocycle containing sulfur, imparts distinct electronic and steric characteristics, influencing the compound's behavior in chemical reactions and interactions. The indole structure is known for its biological significance, often serving as a core framework in various pharmaceuticals and natural products. This compound may exhibit interesting biological activities, making it a subject of interest in medicinal chemistry. Its solubility, stability, and reactivity can vary depending on the solvent and environmental conditions, which are important factors for its application in research and development. Overall, 3-(2-Thienyl)-1H-indole-2-carboxylic acid represents a versatile building block in organic synthesis and drug discovery.
Formula:C13H9NO2S
InChI:InChI=1S/C13H9NO2S/c15-13(16)12-11(10-6-3-7-17-10)8-4-1-2-5-9(8)14-12/h1-7,14H,(H,15,16)
InChI key:InChIKey=DAWOUIGHDXULSR-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(C=2C(N1)=CC=CC2)C3=CC=CS3
Synonyms:- 1H-Indole-2-carboxylic acid, 3-(2-thienyl)-
- 3-(2-Thienyl)-1H-indole-2-carboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.