CAS 1220027-11-1

Methanone, [4-(phenylmethyl)-1-piperazinyl](4,5,6,7-tetrahydro-1H-pyrazolo[4,3-c]pyridin-3-yl)-, hydrochloride (1:1)

Description:

Methanone, [4-(phenylmethyl)-1-piperazinyl](4,5,6,7-tetrahydro-1H-pyrazolo[4,3-c]pyridin-3-yl)-, hydrochloride (1:1), identified by CAS number 1220027-11-1, is a chemical compound characterized by its complex structure, which includes a piperazine moiety and a tetrahydro-pyrazolo-pyridine framework. This compound typically exhibits properties associated with both piperazine derivatives and heterocyclic compounds, potentially influencing its pharmacological activity. As a hydrochloride salt, it is likely to be more soluble in water compared to its free base form, enhancing its bioavailability. The presence of the phenylmethyl group suggests potential interactions with biological targets, making it of interest in medicinal chemistry. Its specific characteristics, such as melting point, solubility, and stability, would depend on the conditions under which it is synthesized and stored. Overall, this compound may have implications in drug development, particularly in the context of neuropharmacology or other therapeutic areas, although detailed studies would be necessary to elucidate its full profile and potential applications.

Formula: C₁₈H₂₃N₅O·ClH

InChI: InChI=1S/C18H23N5O.ClH/c24-18(17-15-12-19-7-6-16(15)20-21-17)23-10-8-22(9-11-23)13-14-4-2-1-3-5-14;/h1-5,19H,6-13H2,(H,20,21);1H

InChI key: InChIKey=WZHVTSHOVLBSEH-UHFFFAOYSA-N

SMILES: C(=O)(C=1C2=C(NN1)CCNC2)N3CCN(CC4=CC=CC=C4)CC3.Cl

Synonyms:

• Methanone, [4-(phenylmethyl)-1-piperazinyl](4,5,6,7-tetrahydro-1H-pyrazolo[4,3-c]pyridin-3-yl)-, hydrochloride (1:1)