CymitQuimica logo

CAS 1220027-14-4

:

Piperidine, 2-methyl-1-(2-pyrrolidinylmethyl)-, hydrochloride (1:2)

Description:
Piperidine, 2-methyl-1-(2-pyrrolidinylmethyl)-, hydrochloride (1:2) is a chemical compound characterized by its piperidine and pyrrolidine moieties, which contribute to its structural complexity and potential biological activity. As a hydrochloride salt, it is typically encountered in a solid form, enhancing its solubility in water and making it suitable for various applications in pharmaceuticals and organic synthesis. The presence of both piperidine and pyrrolidine rings suggests that this compound may exhibit properties associated with central nervous system activity, as both structures are known to interact with neurotransmitter systems. Additionally, the compound's molecular structure may influence its pharmacokinetic properties, such as absorption, distribution, metabolism, and excretion. Safety and handling precautions are essential, as with many nitrogen-containing heterocycles, due to potential toxicity or reactivity. Overall, this compound's unique characteristics make it a subject of interest in medicinal chemistry and related fields.
Formula:C11H22N2·2ClH
InChI:InChI=1S/C11H22N2.2ClH/c1-10-5-2-3-8-13(10)9-11-6-4-7-12-11;;/h10-12H,2-9H2,1H3;2*1H
InChI key:InChIKey=LKILRBCFPKVCQO-UHFFFAOYSA-N
SMILES:C(N1C(C)CCCC1)C2CCCN2.Cl
Synonyms:
  • Piperidine, 2-methyl-1-(2-pyrrolidinylmethyl)-, hydrochloride (1:2)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.