
CAS 1220027-15-5
:3-(3-Methyl-5-isoxazolyl)piperidine
Description:
3-(3-Methyl-5-isoxazolyl)piperidine is a chemical compound characterized by its unique structure, which includes a piperidine ring and an isoxazole moiety. The piperidine ring is a six-membered saturated nitrogen-containing heterocycle, while the isoxazole part contributes to the compound's potential biological activity. This compound is often studied for its pharmacological properties, particularly in the context of neuroscience and medicinal chemistry, as it may interact with various neurotransmitter systems. The presence of the methyl group on the isoxazole ring can influence the compound's lipophilicity and overall reactivity. Additionally, the compound's molecular interactions can be affected by its stereochemistry, which may play a crucial role in its binding affinity to biological targets. Overall, 3-(3-Methyl-5-isoxazolyl)piperidine is of interest in research for its potential applications in drug development and its role in understanding complex biological processes.
Formula:C9H14N2O
InChI:InChI=1S/C9H14N2O/c1-7-5-9(12-11-7)8-3-2-4-10-6-8/h5,8,10H,2-4,6H2,1H3
InChI key:InChIKey=CMZOGZPXPUHNSK-UHFFFAOYSA-N
SMILES:CC=1C=C(ON1)C2CCCNC2
Synonyms:- 3-(3-Methyl-5-isoxazolyl)piperidine
- Piperidine, 3-(3-methyl-5-isoxazolyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
