
CAS 1220027-16-6
:2-(3-Azetidinyloxy)-5-nitropyridine
Description:
2-(3-Azetidinyloxy)-5-nitropyridine is a chemical compound characterized by its unique structural features, which include a pyridine ring substituted with a nitro group and an azetidine-derived ether. The presence of the nitro group typically imparts significant electron-withdrawing properties, influencing the compound's reactivity and potential applications in organic synthesis and medicinal chemistry. The azetidine moiety contributes to the compound's three-dimensional structure, potentially affecting its biological activity and interaction with biological targets. This compound may exhibit properties such as solubility in polar solvents, and its reactivity can be influenced by the functional groups present. As with many nitro-containing compounds, it may also be subject to specific safety and handling considerations due to potential toxicity or explosive characteristics under certain conditions. Overall, 2-(3-Azetidinyloxy)-5-nitropyridine represents a class of compounds that can be of interest in various fields, including pharmaceuticals and materials science, due to their diverse chemical properties and potential applications.
Formula:C8H9N3O3
InChI:InChI=1S/C8H9N3O3/c12-11(13)6-1-2-8(10-3-6)14-7-4-9-5-7/h1-3,7,9H,4-5H2
InChI key:InChIKey=QTSLAQHZNYRVPX-UHFFFAOYSA-N
SMILES:O(C1=CC=C(N(=O)=O)C=N1)C2CNC2
Synonyms:- 2-(3-Azetidinyloxy)-5-nitropyridine
- Pyridine, 2-(3-azetidinyloxy)-5-nitro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.