CAS 1220027-25-7

Piperidine, 3-[[(2,4-dichlorophenyl)methoxy]methyl]-, hydrochloride (1:1)

Description:

Piperidine, 3-[[[2,4-dichlorophenyl)methoxy]methyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine core, which is a six-membered saturated heterocyclic ring containing one nitrogen atom. The presence of a 2,4-dichlorophenyl group indicates that the compound has significant aromatic characteristics, contributing to its potential biological activity. The methoxy group attached to the phenyl ring enhances its solubility and reactivity. As a hydrochloride salt, it is typically more stable and soluble in water compared to its free base form, making it suitable for various applications, including pharmaceutical formulations. The compound may exhibit properties such as analgesic or psychoactive effects, common to many piperidine derivatives. Its specific interactions and efficacy would depend on its molecular structure and the presence of substituents. Safety and handling precautions are essential, as with many chemical substances, due to potential toxicity or reactivity. Overall, this compound represents a class of chemicals with diverse applications in medicinal chemistry and research.

Formula: C₁₃H₁₇Cl₂NO·ClH

InChI: InChI=1S/C13H17Cl2NO.ClH/c14-12-4-3-11(13(15)6-12)9-17-8-10-2-1-5-16-7-10;/h3-4,6,10,16H,1-2,5,7-9H2;1H

InChI key: InChIKey=STIRHHWWHDKJBW-UHFFFAOYSA-N

SMILES: C(OCC1CCCNC1)C2=C(Cl)C=C(Cl)C=C2.Cl

Synonyms:

• Piperidine, 3-[[(2,4-dichlorophenyl)methoxy]methyl]-, hydrochloride (1:1)