CAS 1220027-26-8

Pyrrolidine, 3-[[2-bromo-4-(phenylmethyl)phenoxy]methyl]-, hydrochloride (1:1)

Description:

Pyrrolidine, 3-[[2-bromo-4-(phenylmethyl)phenoxy]methyl]-, hydrochloride (1:1) is a chemical compound characterized by its pyrrolidine ring structure, which is a five-membered saturated heterocycle containing one nitrogen atom. The presence of the bromo and phenylmethyl groups indicates that this compound has significant functional diversity, potentially influencing its reactivity and biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which can enhance its utility in pharmaceutical applications. The compound may exhibit properties such as being a potential ligand or inhibitor in various biochemical pathways, making it of interest in medicinal chemistry. Its specific interactions and effects would depend on the context of its use, including concentration and the biological system involved. Safety and handling precautions should be observed due to the presence of bromine, which can be hazardous. Overall, this compound represents a complex structure with potential applications in drug development and research.

Formula: C₁₈H₂₁BrClNO

InChI: InChI=1S/C18H20BrNO.ClH/c19-17-11-15(10-14-4-2-1-3-5-14)6-7-18(17)21-13-16-8-9-20-12-16;/h1-7,11,16,20H,8-10,12-13H2;1H

InChI key: InChIKey=GGZYZSZAAOEBAB-UHFFFAOYSA-N

SMILES: C(C1=CC(Br)=C(OCC2CCNC2)C=C1)C3=CC=CC=C3.Cl

Synonyms:

• Pyrrolidine, 3-[[2-bromo-4-(phenylmethyl)phenoxy]methyl]-, hydrochloride (1:1)
• 3-[(4-Benzyl-2-bromophenoxy)methyl]pyrrolidinehydrochloride