CAS 1220027-28-0
:3-[4-Bromo-2-(1-methylethyl)phenoxy]azetidine
Description:
3-[4-Bromo-2-(1-methylethyl)phenoxy]azetidine, identified by its CAS number 1220027-28-0, is a chemical compound characterized by its azetidine ring structure, which is a four-membered saturated heterocycle containing one nitrogen atom. The presence of a phenoxy group, specifically a 4-bromo-2-(1-methylethyl)phenyl moiety, contributes to its unique properties, including potential biological activity. The bromine substituent can enhance the compound's reactivity and influence its interactions with biological targets. The isopropyl group (1-methylethyl) adds steric bulk, which may affect the compound's solubility and lipophilicity. This compound may be of interest in medicinal chemistry and drug development due to its structural features, which could impart specific pharmacological properties. As with many organic compounds, its stability, reactivity, and potential applications would depend on various factors, including environmental conditions and the presence of other chemical species. Further studies would be necessary to fully elucidate its characteristics and potential uses in various fields.
Formula:C12H16BrNO
InChI:InChI=1S/C12H16BrNO/c1-8(2)11-5-9(13)3-4-12(11)15-10-6-14-7-10/h3-5,8,10,14H,6-7H2,1-2H3
InChI key:InChIKey=OGQPIONTQZPGLY-UHFFFAOYSA-N
SMILES:O(C1=C(C(C)C)C=C(Br)C=C1)C2CNC2
Synonyms:- Azetidine, 3-[4-bromo-2-(1-methylethyl)phenoxy]-
- 3-[4-Bromo-2-(1-methylethyl)phenoxy]azetidine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.