CAS 1220027-29-1

Cyclopentanecarboxylic acid, 2-(2-piperidinyl)ethyl ester, hydrochloride (1:1)

Description:

Cyclopentanecarboxylic acid, 2-(2-piperidinyl)ethyl ester, hydrochloride (1:1) is a chemical compound characterized by its ester functional group derived from cyclopentanecarboxylic acid and a piperidine moiety. This compound typically appears as a white to off-white crystalline solid, indicating its potential stability and solubility in polar solvents due to the presence of the hydrochloride salt form. The piperidine ring contributes to its basicity and may influence its pharmacological properties, making it of interest in medicinal chemistry. The presence of the cyclopentane structure can impart unique steric and electronic properties, which may affect its reactivity and interactions with biological targets. As a hydrochloride salt, it is likely to exhibit improved solubility in aqueous environments, enhancing its bioavailability for potential therapeutic applications. Overall, this compound's characteristics suggest it may be useful in various chemical and pharmaceutical contexts, although specific applications would depend on further research and development.

Formula: C₁₃H₂₃NO₂·ClH

InChI: InChI=1S/C13H23NO2.ClH/c15-13(11-5-1-2-6-11)16-10-8-12-7-3-4-9-14-12;/h11-12,14H,1-10H2;1H

InChI key: InChIKey=SWZIJAYGMMNPAF-UHFFFAOYSA-N

SMILES: C(OCCC1CCCCN1)(=O)C2CCCC2.Cl

Synonyms:

• Cyclopentanecarboxylic acid, 2-(2-piperidinyl)ethyl ester, hydrochloride (1:1)