CAS 1220027-32-6

2-Pyrrolidinemethanamine, N-butyl-N-methyl-, hydrochloride (1:2)

Description:

2-Pyrrolidinemethanamine, N-butyl-N-methyl-, hydrochloride (1:2) is a chemical compound characterized by its amine functional groups and a pyrrolidine ring structure. This compound is a hydrochloride salt, indicating that it is the hydrochloric acid salt of the base form, which enhances its solubility in water and makes it suitable for various applications, particularly in pharmaceutical formulations. The presence of both butyl and methyl groups contributes to its hydrophobic characteristics, influencing its interaction with biological systems. As a tertiary amine, it can participate in hydrogen bonding, which may affect its reactivity and biological activity. The compound's molecular structure suggests potential uses in medicinal chemistry, particularly in the development of drugs targeting the central nervous system or other therapeutic areas. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity. Further studies would be necessary to fully elucidate its pharmacological properties and potential applications.

Formula: C₁₀H₂₂N₂·2ClH

InChI: InChI=1S/C10H22N2.2ClH/c1-3-4-8-12(2)9-10-6-5-7-11-10;;/h10-11H,3-9H2,1-2H3;2*1H

InChI key: InChIKey=AAIMYABEGFIURG-UHFFFAOYSA-N

SMILES: C(N(CCCC)C)C1CCCN1.Cl

Synonyms:

• 2-Pyrrolidinemethanamine, N-butyl-N-methyl-, hydrochloride (1:2)