CymitQuimica logo

CAS 1220027-40-6

:

Cyclopentanecarboxylic acid, 4-piperidinylmethyl ester, hydrochloride (1:1)

Description:
Cyclopentanecarboxylic acid, 4-piperidinylmethyl ester, hydrochloride (1:1) is a chemical compound characterized by its ester functional group derived from cyclopentanecarboxylic acid and a piperidine moiety. This compound typically appears as a white to off-white crystalline solid and is soluble in polar solvents such as water and alcohols, owing to the presence of the hydrochloride salt form. The piperidine ring contributes to its basicity and potential pharmacological properties, making it of interest in medicinal chemistry. The hydrochloride form enhances its stability and solubility, which is beneficial for various applications, including drug formulation. Its molecular structure suggests potential interactions with biological systems, which may lead to various therapeutic effects. As with many chemical substances, handling should be conducted with care, following appropriate safety protocols to mitigate any risks associated with its use. Overall, this compound exemplifies the intersection of organic chemistry and pharmacology, highlighting the importance of structural characteristics in determining chemical behavior and application.
Formula:C12H21NO2·ClH
InChI:InChI=1S/C12H21NO2.ClH/c14-12(11-3-1-2-4-11)15-9-10-5-7-13-8-6-10;/h10-11,13H,1-9H2;1H
InChI key:InChIKey=HHYCUPTXDKROMI-UHFFFAOYSA-N
SMILES:C(OCC1CCNCC1)(=O)C2CCCC2.Cl
Synonyms:
  • Cyclopentanecarboxylic acid, 4-piperidinylmethyl ester, hydrochloride (1:1)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.