
CAS 1220027-46-2
:1H-Indole, 2,3-dihydro-1-(2-pyrrolidinylmethyl)-, hydrochloride (1:2)
Description:
1H-Indole, 2,3-dihydro-1-(2-pyrrolidinylmethyl)-, hydrochloride (1:2) is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This specific derivative features a dihydroindole moiety and a pyrrolidine group, indicating the presence of a saturated five-membered nitrogen-containing ring. The hydrochloride designation suggests that the compound is in its salt form, which typically enhances its solubility in water and stability. The compound may exhibit biological activity, potentially influencing neurotransmitter systems or serving as a precursor in the synthesis of pharmaceuticals. Its molecular interactions can be influenced by the presence of the pyrrolidine group, which may contribute to its pharmacological properties. As with many indole derivatives, it may be of interest in medicinal chemistry for its potential applications in treating various conditions. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.
Formula:C13H18N2·2ClH
InChI:InChI=1S/C13H18N2.2ClH/c1-2-6-13-11(4-1)7-9-15(13)10-12-5-3-8-14-12;;/h1-2,4,6,12,14H,3,5,7-10H2;2*1H
InChI key:InChIKey=XWSINJZXLLXLES-UHFFFAOYSA-N
SMILES:C(N1C=2C(CC1)=CC=CC2)C3CCCN3.Cl
Synonyms:- 1H-Indole, 2,3-dihydro-1-(2-pyrrolidinylmethyl)-, hydrochloride (1:2)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.