CAS 1220027-47-3

2-Piperazinone, 4-(2-pyrrolidinylmethyl)-, hydrochloride (1:2)

Description:

2-Piperazinone, 4-(2-pyrrolidinylmethyl)-, hydrochloride (1:2) is a chemical compound characterized by its piperazine and pyrrolidine moieties, which contribute to its potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in pharmaceutical applications. The presence of the piperazinone structure suggests potential interactions with neurotransmitter systems, making it of interest in medicinal chemistry, particularly in the development of psychoactive or therapeutic agents. The compound's molecular structure includes a piperazine ring, which is known for its ability to form hydrogen bonds, influencing its reactivity and interaction with biological targets. Additionally, the pyrrolidine group may impart unique steric and electronic properties, affecting the compound's pharmacokinetics and pharmacodynamics. Overall, this compound's characteristics make it a subject of interest for further research in drug development and related fields.

Formula: C₉H₁₇N₃O·2ClH

InChI: InChI=1S/C9H17N3O.2ClH/c13-9-7-12(5-4-11-9)6-8-2-1-3-10-8;;/h8,10H,1-7H2,(H,11,13);2*1H

InChI key: InChIKey=DHMVKHCRCQEPQE-UHFFFAOYSA-N

SMILES: C(N1CC(=O)NCC1)C2CCCN2.Cl

Synonyms:

• 2-Piperazinone, 4-(2-pyrrolidinylmethyl)-, hydrochloride (1:2)