CymitQuimica logo

CAS 1220027-50-8

:

3-(2-Bromo-4-ethylphenoxy)azetidine

Description:
3-(2-Bromo-4-ethylphenoxy)azetidine is a chemical compound characterized by its azetidine ring, which is a four-membered saturated heterocyclic structure containing one nitrogen atom. The compound features a phenoxy group, specifically a 2-bromo-4-ethylphenyl moiety, which contributes to its unique properties and reactivity. The presence of the bromine atom introduces a halogen functionality, potentially influencing the compound's reactivity and interactions with other molecules. The ethyl group enhances the hydrophobic character of the molecule, which may affect its solubility and biological activity. This compound may be of interest in medicinal chemistry and material science due to its structural features, which could impart specific pharmacological properties or facilitate interactions in various chemical environments. As with many organic compounds, its behavior in reactions, stability, and potential applications would depend on the specific conditions and the presence of other functional groups. Further studies would be necessary to fully elucidate its properties and potential uses in various fields.
Formula:C11H14BrNO
InChI:InChI=1S/C11H14BrNO/c1-2-8-3-4-11(10(12)5-8)14-9-6-13-7-9/h3-5,9,13H,2,6-7H2,1H3
InChI key:InChIKey=VEALANXYYPUGHQ-UHFFFAOYSA-N
SMILES:O(C1=C(Br)C=C(CC)C=C1)C2CNC2
Synonyms:
  • 3-(2-Bromo-4-ethylphenoxy)azetidine
  • Azetidine, 3-(2-bromo-4-ethylphenoxy)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.