CAS 1220027-61-1

2-Pyrrolidinemethanamine, N-methyl-N-[(tetrahydro-2H-pyran-4-yl)methyl]-, hydrochloride (1:2)

Description:

2-Pyrrolidinemethanamine, N-methyl-N-[(tetrahydro-2H-pyran-4-yl)methyl]-, hydrochloride (1:2) is a chemical compound characterized by its complex structure, which includes a pyrrolidine ring and a tetrahydropyran moiety. This compound is typically encountered as a hydrochloride salt, enhancing its solubility in water and making it suitable for various applications in medicinal chemistry and pharmacology. The presence of the N-methyl group contributes to its basicity and potential interactions with biological targets. Its molecular structure suggests potential uses in the development of pharmaceuticals, particularly in areas related to central nervous system activity or as a building block for more complex molecules. The compound's specific properties, such as melting point, solubility, and reactivity, would depend on its formulation and the conditions under which it is studied. As with many amines, it may exhibit basic characteristics and can participate in various chemical reactions, including alkylation and acylation, making it a versatile intermediate in organic synthesis.

Formula: C₁₂H₂₄N₂O·2ClH

InChI: InChI=1S/C12H24N2O.2ClH/c1-14(10-12-3-2-6-13-12)9-11-4-7-15-8-5-11;;/h11-13H,2-10H2,1H3;2*1H

InChI key: InChIKey=ZPJWDMDAOHLCKP-UHFFFAOYSA-N

SMILES: C(N(CC1CCCN1)C)C2CCOCC2.Cl

Synonyms:

• 2-Pyrrolidinemethanamine, N-methyl-N-[(tetrahydro-2H-pyran-4-yl)methyl]-, hydrochloride (1:2)