
CAS 1220027-64-4
:Piperidine, 3-(2-propylphenoxy)-, hydrochloride (1:1)
Description:
Piperidine, 3-(2-propylphenoxy)-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated heterocycle containing one nitrogen atom. The compound features a 2-propylphenoxy group, indicating the presence of a phenyl ring substituted with a propyl group and an ether linkage to the piperidine nitrogen. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, including pharmaceuticals and research. The presence of the hydrochloride indicates that it can exist as a stable crystalline solid under standard conditions. This compound may exhibit biological activity, potentially influencing neurotransmitter systems, given the structural similarities to other piperidine derivatives. However, specific pharmacological properties, toxicity, and safety profiles would require further investigation through empirical studies. As with all chemical substances, proper handling and safety precautions should be observed, particularly in laboratory settings.
Formula:C14H21NO·ClH
InChI:InChI=1S/C14H21NO.ClH/c1-2-6-12-7-3-4-9-14(12)16-13-8-5-10-15-11-13;/h3-4,7,9,13,15H,2,5-6,8,10-11H2,1H3;1H
InChI key:InChIKey=JSXFGSOERHLSMD-UHFFFAOYSA-N
SMILES:O(C1=C(CCC)C=CC=C1)C2CCCNC2.Cl
Synonyms:- Piperidine, 3-(2-propylphenoxy)-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.