CAS 1220027-73-5
:3-(2-Bromo-4-methoxyphenoxy)azetidine
Description:
3-(2-Bromo-4-methoxyphenoxy)azetidine is a chemical compound characterized by its azetidine ring, which is a four-membered saturated heterocyclic structure containing one nitrogen atom. The compound features a phenoxy group, specifically a 2-bromo-4-methoxy-substituted phenyl moiety, which contributes to its chemical properties and potential biological activity. The presence of the bromine atom and the methoxy group can influence the compound's reactivity, solubility, and interaction with biological targets. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its molecular structure suggests potential applications in drug development, particularly in areas where modifications to the azetidine framework can enhance therapeutic efficacy. As with many organic compounds, the specific characteristics such as melting point, boiling point, and solubility would depend on the compound's purity and the conditions under which they are measured. Safety and handling precautions should be observed due to the presence of bromine, which can be hazardous.
Formula:C10H12BrNO2
InChI:InChI=1S/C10H12BrNO2/c1-13-7-2-3-10(9(11)4-7)14-8-5-12-6-8/h2-4,8,12H,5-6H2,1H3
InChI key:InChIKey=HLWKYOXBHUQIAN-UHFFFAOYSA-N
SMILES:O(C1=C(Br)C=C(OC)C=C1)C2CNC2
Synonyms:- 3-(2-Bromo-4-methoxyphenoxy)azetidine
- Azetidine, 3-(2-bromo-4-methoxyphenoxy)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.