CymitQuimica logo

CAS 1220027-74-6

:

5-Bromo-4-methyl-N-(1-methylpropyl)-2-pyridinamine

Description:
5-Bromo-4-methyl-N-(1-methylpropyl)-2-pyridinamine is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a bromine atom at the 5-position and a methyl group at the 4-position of the pyridine ring contributes to its unique reactivity and physical properties. The N-(1-methylpropyl) substituent indicates that the compound has an alkyl amine functional group, which can influence its solubility and interaction with biological systems. This compound may exhibit properties typical of amines, such as basicity and potential nucleophilicity, making it of interest in various chemical reactions and applications. Its molecular structure suggests potential uses in pharmaceuticals or agrochemicals, where modifications to the pyridine ring can enhance biological activity. As with many organic compounds, safety and handling precautions should be observed, particularly due to the presence of bromine, which can be hazardous.
Formula:C10H15BrN2
InChI:InChI=1S/C10H15BrN2/c1-4-8(3)13-10-5-7(2)9(11)6-12-10/h5-6,8H,4H2,1-3H3,(H,12,13)
InChI key:InChIKey=XQOMYTJOOJEOEN-UHFFFAOYSA-N
SMILES:N(C(CC)C)C1=CC(C)=C(Br)C=N1
Synonyms:
  • 2-Pyridinamine, 5-bromo-4-methyl-N-(1-methylpropyl)-
  • 5-Bromo-4-methyl-N-(1-methylpropyl)-2-pyridinamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.