CAS 1220027-75-7

1-(2-Pyridinylmethyl)-3-pyrrolidineacetic acid

Description:

1-(2-Pyridinylmethyl)-3-pyrrolidineacetic acid, identified by its CAS number 1220027-75-7, is a chemical compound characterized by its unique structure that includes a pyridine ring and a pyrrolidine moiety. This compound typically exhibits properties associated with both basic and acidic functionalities due to the presence of the pyridine nitrogen and the carboxylic acid group. It is likely to be a white to off-white solid at room temperature, with solubility in polar solvents such as water and alcohols, owing to its polar functional groups. The compound may exhibit biological activity, potentially interacting with various receptors or enzymes, making it of interest in medicinal chemistry. Its molecular structure suggests it could participate in hydrogen bonding, influencing its reactivity and interaction with other molecules. Additionally, the presence of the pyridine and pyrrolidine rings may contribute to its lipophilicity, affecting its pharmacokinetic properties. Overall, this compound's characteristics make it a subject of interest for further research in chemical and pharmaceutical applications.

Formula: C₁₂H₁₆N₂O₂

InChI: InChI=1S/C12H16N2O2/c15-12(16)7-10-4-6-14(8-10)9-11-3-1-2-5-13-11/h1-3,5,10H,4,6-9H2,(H,15,16)

InChI key: InChIKey=OTAYBGXXWCJNOO-UHFFFAOYSA-N

SMILES: C(N1CC(CC(O)=O)CC1)C2=CC=CC=N2

Synonyms:

• 3-Pyrrolidineacetic acid, 1-(2-pyridinylmethyl)-
• 1-(2-Pyridinylmethyl)-3-pyrrolidineacetic acid