
CAS 1220027-79-1
:Pyrrolidine, 3-[4-chloro-2-(1-methylethyl)phenoxy]-, hydrochloride (1:1)
Description:
Pyrrolidine, 3-[4-chloro-2-(1-methylethyl)phenoxy]-, hydrochloride (1:1) is a chemical compound characterized by its pyrrolidine core, which is a five-membered saturated heterocyclic amine. The presence of a 4-chloro-2-(1-methylethyl)phenoxy group indicates that it has a chlorinated aromatic structure, contributing to its potential biological activity. The hydrochloride form suggests that the compound is a salt, which typically enhances its solubility in water and may influence its pharmacokinetic properties. This compound may exhibit various properties such as being a potential ligand for biological receptors or enzymes, and its specific interactions would depend on the functional groups present. The presence of the isopropyl group (1-methylethyl) may also affect its lipophilicity and overall reactivity. As with many pyrrolidine derivatives, it may have applications in medicinal chemistry, particularly in the development of pharmaceuticals. However, detailed studies would be necessary to fully understand its biological activity and potential uses.
Formula:C13H18ClNO·ClH
InChI:InChI=1S/C13H18ClNO.ClH/c1-9(2)12-7-10(14)3-4-13(12)16-11-5-6-15-8-11;/h3-4,7,9,11,15H,5-6,8H2,1-2H3;1H
InChI key:InChIKey=HFCLYJPCEHVAQF-UHFFFAOYSA-N
SMILES:O(C1=C(C(C)C)C=C(Cl)C=C1)C2CCNC2.Cl
Synonyms:- Pyrrolidine, 3-[4-chloro-2-(1-methylethyl)phenoxy]-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.