CAS 1220027-84-8
:3-(4-Bromo-2-nitrophenoxy)azetidine
Description:
3-(4-Bromo-2-nitrophenoxy)azetidine is a chemical compound characterized by its azetidine ring, which is a four-membered saturated heterocyclic structure containing one nitrogen atom. The compound features a 4-bromo-2-nitrophenoxy substituent, indicating the presence of a bromine atom and a nitro group on a phenoxy moiety, which contributes to its reactivity and potential biological activity. The presence of the nitro group typically enhances the compound's electrophilicity, making it a candidate for various chemical reactions, including nucleophilic substitutions. This compound may exhibit interesting pharmacological properties due to its structural features, which can influence its interaction with biological targets. Additionally, the bromine atom can serve as a site for further functionalization, allowing for the development of derivatives with tailored properties. As with many organic compounds, the solubility, stability, and reactivity of 3-(4-Bromo-2-nitrophenoxy)azetidine will depend on the specific conditions under which it is handled, including solvent choice and temperature.
Formula:C9H9BrN2O3
InChI:InChI=1S/C9H9BrN2O3/c10-6-1-2-9(8(3-6)12(13)14)15-7-4-11-5-7/h1-3,7,11H,4-5H2
InChI key:InChIKey=JBIQIBUVKUNXDH-UHFFFAOYSA-N
SMILES:O(C1=C(N(=O)=O)C=C(Br)C=C1)C2CNC2
Synonyms:- Azetidine, 3-(4-bromo-2-nitrophenoxy)-
- 3-(4-Bromo-2-nitrophenoxy)azetidine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.