CAS 1220027-86-0

Piperidine, 2-[2-(4-chloro-2-nitrophenoxy)ethyl]-, hydrochloride (1:1)

Description:

Piperidine, 2-[2-(4-chloro-2-nitrophenoxy)ethyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine core, which is a six-membered saturated heterocyclic ring containing one nitrogen atom. This compound features a side chain that includes a 4-chloro-2-nitrophenoxy group, contributing to its unique properties and potential biological activity. As a hydrochloride salt, it is typically more soluble in water than its free base form, enhancing its utility in various applications, particularly in pharmaceutical formulations. The presence of the nitro and chloro substituents suggests potential reactivity and biological interactions, making it of interest in medicinal chemistry. Its molecular structure indicates that it may exhibit specific pharmacological effects, although detailed studies would be necessary to elucidate its mechanism of action and therapeutic potential. Safety and handling precautions should be observed due to the presence of halogenated and nitro groups, which can pose environmental and health risks.

Formula: C₁₃H₁₇ClN₂O₃·ClH

InChI: InChI=1S/C13H17ClN2O3.ClH/c14-10-4-5-13(12(9-10)16(17)18)19-8-6-11-3-1-2-7-15-11;/h4-5,9,11,15H,1-3,6-8H2;1H

InChI key: InChIKey=OBNUXVYKFZMDFO-UHFFFAOYSA-N

SMILES: N(=O)(=O)C1=C(OCCC2CCCCN2)C=CC(Cl)=C1.Cl

Synonyms:

• Piperidine, 2-[2-(4-chloro-2-nitrophenoxy)ethyl]-, hydrochloride (1:1)