CymitQuimica logo

CAS 1220027-87-1

:

3-[4-Chloro-2-(1-methylethyl)phenoxy]azetidine

Description:
3-[4-Chloro-2-(1-methylethyl)phenoxy]azetidine, identified by its CAS number 1220027-87-1, is a chemical compound characterized by its azetidine ring structure, which is a four-membered saturated heterocycle containing one nitrogen atom. The presence of a phenoxy group, specifically a 4-chloro-2-(1-methylethyl)phenyl moiety, contributes to its unique properties, including potential biological activity. The chloro substituent may enhance the compound's lipophilicity, influencing its interaction with biological membranes. This compound may exhibit specific reactivity patterns due to the azetidine nitrogen, which can participate in various chemical reactions, including nucleophilic substitutions. Its structural features suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. However, detailed studies on its pharmacokinetics, toxicity, and specific applications would be necessary to fully understand its behavior and utility in various chemical contexts. As with any chemical substance, proper handling and safety measures should be observed due to potential hazards associated with its components.
Formula:C12H16ClNO
InChI:InChI=1S/C12H16ClNO/c1-8(2)11-5-9(13)3-4-12(11)15-10-6-14-7-10/h3-5,8,10,14H,6-7H2,1-2H3
InChI key:InChIKey=DTXCVLHGBNCPOH-UHFFFAOYSA-N
SMILES:O(C1=C(C(C)C)C=C(Cl)C=C1)C2CNC2
Synonyms:
  • Azetidine, 3-[4-chloro-2-(1-methylethyl)phenoxy]-
  • 3-[4-Chloro-2-(1-methylethyl)phenoxy]azetidine
  • 3-(4-Chloro-2-isopropylphenoxy)azetidine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.