CymitQuimica logo

CAS 1220027-90-6

:

1-[3-Chloro-5-(trifluoromethyl)-2-pyridinyl]-2,3-dihydro-1H-indole

Description:
1-[3-Chloro-5-(trifluoromethyl)-2-pyridinyl]-2,3-dihydro-1H-indole is a chemical compound characterized by its complex structure, which includes a pyridine ring and an indole moiety. The presence of a chloro group and a trifluoromethyl group contributes to its unique chemical properties, influencing its reactivity and potential applications. This compound is typically classified as a heterocyclic organic compound due to the incorporation of nitrogen atoms in its rings. Its molecular structure suggests potential for interactions in biological systems, making it of interest in medicinal chemistry and drug development. The trifluoromethyl group often enhances lipophilicity, which can affect the compound's pharmacokinetics. Additionally, the chlorine substituent may impart specific electronic properties that can influence the compound's behavior in chemical reactions. Overall, this compound's characteristics make it a subject of interest for further research, particularly in the fields of pharmaceuticals and agrochemicals.
Formula:C14H10ClF3N2
InChI:InChI=1S/C14H10ClF3N2/c15-11-7-10(14(16,17)18)8-19-13(11)20-6-5-9-3-1-2-4-12(9)20/h1-4,7-8H,5-6H2
InChI key:InChIKey=POEANEQEVYSCLJ-UHFFFAOYSA-N
SMILES:ClC1=C(N2C=3C(CC2)=CC=CC3)N=CC(C(F)(F)F)=C1
Synonyms:
  • 1H-Indole, 1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-2,3-dihydro-
  • 1-[3-Chloro-5-(trifluoromethyl)-2-pyridinyl]-2,3-dihydro-1H-indole
  • 1-[3-Chloro-5-(trifluoromethyl)pyridin-2-yl]-2,3-dihydroindole
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.