
CAS 1220027-92-8
:4-Piperidinecarboxamide, N-(1-methylpropyl)-, hydrochloride (1:1)
Description:
4-Piperidinecarboxamide, N-(1-methylpropyl)-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated heterocycle containing one nitrogen atom. This compound features a carboxamide functional group, contributing to its potential as a pharmacological agent. The presence of the N-(1-methylpropyl) substituent indicates that it has an alkyl side chain, which can influence its biological activity and solubility. As a hydrochloride salt, it is typically more soluble in water than its free base form, enhancing its utility in pharmaceutical formulations. The compound may exhibit properties such as being a potential ligand for various biological targets, and its hydrochloride form can stabilize the molecule, making it easier to handle and store. Safety and handling precautions should be observed, as with any chemical substance, particularly in laboratory or industrial settings. Further studies would be necessary to fully elucidate its pharmacodynamics and pharmacokinetics.
Formula:C10H20N2O·ClH
InChI:InChI=1S/C10H20N2O.ClH/c1-3-8(2)12-10(13)9-4-6-11-7-5-9;/h8-9,11H,3-7H2,1-2H3,(H,12,13);1H
InChI key:InChIKey=GURROUTXMODVPG-UHFFFAOYSA-N
SMILES:C(NC(CC)C)(=O)C1CCNCC1.Cl
Synonyms:- 4-Piperidinecarboxamide, N-(1-methylpropyl)-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.