
CAS 1220027-94-0
:Piperidine, 3-[[4-chloro-2-(1-methylethyl)phenoxy]methyl]-, hydrochloride (1:1)
Description:
Piperidine, 3-[[4-chloro-2-(1-methylethyl)phenoxy]methyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated nitrogen-containing heterocycle. The presence of a chloro-substituted phenyl group and a branched alkyl group (isopropyl) contributes to its unique properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceuticals. The compound may exhibit biological activity, potentially acting as a ligand or modulator in biochemical pathways. Its molecular structure suggests it could interact with specific receptors or enzymes, making it of interest in medicinal chemistry. Safety data should be consulted for handling and exposure risks, as compounds with halogen substituents can exhibit varying degrees of toxicity. Overall, this compound's characteristics make it a subject of interest for further research in drug development and chemical synthesis.
Formula:C15H22ClNO·ClH
InChI:InChI=1S/C15H22ClNO.ClH/c1-11(2)14-8-13(16)5-6-15(14)18-10-12-4-3-7-17-9-12;/h5-6,8,11-12,17H,3-4,7,9-10H2,1-2H3;1H
InChI key:InChIKey=MGZMEPMJACSKAF-UHFFFAOYSA-N
SMILES:O(CC1CCCNC1)C2=C(C(C)C)C=C(Cl)C=C2.Cl
Synonyms:- Piperidine, 3-[[4-chloro-2-(1-methylethyl)phenoxy]methyl]-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.