CAS 1220028-00-1
:Ethyl 2-(3-azetidinyloxy)benzoate
Description:
Ethyl 2-(3-azetidinyloxy)benzoate is an organic compound characterized by its ester functional group, which is derived from benzoic acid and ethanol. The presence of the azetidine ring, a four-membered nitrogen-containing heterocycle, contributes to its unique chemical properties and potential biological activity. This compound typically exhibits moderate polarity due to the ester and ether functionalities, influencing its solubility in various organic solvents. Ethyl 2-(3-azetidinyloxy)benzoate may participate in various chemical reactions, such as nucleophilic substitutions or hydrolysis, depending on the reaction conditions. Its structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as the azetidine moiety is often associated with bioactive compounds. Additionally, the compound's stability and reactivity can be influenced by factors such as pH and temperature, making it important to consider these conditions in practical applications. Overall, this compound represents a fascinating intersection of organic chemistry and potential therapeutic utility.
Formula:C12H15NO3
InChI:InChI=1S/C12H15NO3/c1-2-15-12(14)10-5-3-4-6-11(10)16-9-7-13-8-9/h3-6,9,13H,2,7-8H2,1H3
InChI key:InChIKey=HZZDHQROOJYGKH-UHFFFAOYSA-N
SMILES:O(C1=C(C(OCC)=O)C=CC=C1)C2CNC2
Synonyms:- Benzoic acid, 2-(3-azetidinyloxy)-, ethyl ester
- Ethyl 2-(3-azetidinyloxy)benzoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
