CAS 1220028-05-6

Ethanone, 1-[2-[2-(2-piperidinyl)ethoxy]phenyl]-, hydrochloride (1:1)

Description:

Ethanone, 1-[2-[2-(2-piperidinyl)ethoxy]phenyl]-, hydrochloride (1:1), identified by CAS number 1220028-05-6, is a chemical compound that features a piperidine moiety, which is a six-membered ring containing nitrogen. This compound is characterized by its ether and ketone functional groups, contributing to its potential reactivity and solubility properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which can enhance its bioavailability in pharmaceutical applications. The presence of the piperidine group suggests potential pharmacological activity, possibly influencing central nervous system functions. The compound's structure indicates it may interact with various biological targets, making it of interest in medicinal chemistry. However, specific details regarding its toxicity, stability, and detailed pharmacokinetics would require further investigation through empirical studies. Overall, this compound exemplifies the complexity of synthetic organic chemistry and its applications in drug development.

Formula: C₁₅H₂₁NO₂·ClH

InChI: InChI=1S/C15H21NO2.ClH/c1-12(17)14-7-2-3-8-15(14)18-11-9-13-6-4-5-10-16-13;/h2-3,7-8,13,16H,4-6,9-11H2,1H3;1H

InChI key: InChIKey=CDQSPDZYFNRIMA-UHFFFAOYSA-N

SMILES: C(C)(=O)C1=C(OCCC2CCCCN2)C=CC=C1.Cl

Synonyms:

• Ethanone, 1-[2-[2-(2-piperidinyl)ethoxy]phenyl]-, hydrochloride (1:1)