CymitQuimica logo

CAS 1220028-09-0

:

3-Chloro-N-methyl-N-[(tetrahydro-2H-pyran-4-yl)methyl]-5-(trifluoromethyl)-2-pyridinamine

Description:
3-Chloro-N-methyl-N-[(tetrahydro-2H-pyran-4-yl)methyl]-5-(trifluoromethyl)-2-pyridinamine is a chemical compound characterized by its complex structure, which includes a pyridine ring, a chloro substituent, and a trifluoromethyl group. The presence of the tetrahydro-2H-pyran moiety contributes to its potential as a versatile building block in organic synthesis. This compound is likely to exhibit properties typical of amines, such as basicity and the ability to form hydrogen bonds, which can influence its solubility and reactivity. The trifluoromethyl group is known to enhance lipophilicity and can affect the compound's biological activity, making it of interest in medicinal chemistry. Additionally, the chloro group may participate in nucleophilic substitution reactions, further expanding its utility in synthetic applications. Overall, this compound's unique functional groups and structural features suggest potential applications in pharmaceuticals or agrochemicals, although specific biological or chemical properties would require empirical investigation.
Formula:C13H16ClF3N2O
InChI:InChI=1S/C13H16ClF3N2O/c1-19(8-9-2-4-20-5-3-9)12-11(14)6-10(7-18-12)13(15,16)17/h6-7,9H,2-5,8H2,1H3
InChI key:InChIKey=MPROCLVEFOAPRU-UHFFFAOYSA-N
SMILES:N(CC1CCOCC1)(C)C2=C(Cl)C=C(C(F)(F)F)C=N2
Synonyms:
  • 3-Chloro-N-methyl-N-[(tetrahydro-2H-pyran-4-yl)methyl]-5-(trifluoromethyl)-2-pyridinamine
  • 2-Pyridinamine, 3-chloro-N-methyl-N-[(tetrahydro-2H-pyran-4-yl)methyl]-5-(trifluoromethyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.