CAS 1220028-10-3

Quinoline, 5-chloro-8-[2-(4-piperidinyl)ethoxy]-, hydrochloride (1:1)

Description:

Quinoline, 5-chloro-8-[2-(4-piperidinyl)ethoxy]-, hydrochloride (1:1) is a chemical compound characterized by its quinoline backbone, which is a bicyclic aromatic structure known for its heterocyclic properties. The presence of a chlorine atom at the 5-position and a piperidine-derived ethoxy group at the 8-position contributes to its unique chemical behavior and potential biological activity. As a hydrochloride salt, it is typically more soluble in water, enhancing its utility in pharmaceutical applications. This compound may exhibit various pharmacological properties, potentially including antimicrobial or antitumor activities, owing to the structural features that allow for interaction with biological targets. The piperidine moiety can influence its binding affinity and selectivity for specific receptors or enzymes. Overall, the characteristics of this compound suggest it may be of interest in medicinal chemistry and drug development, although specific biological activities and mechanisms would require further investigation through empirical studies.

Formula: C₁₆H₁₉ClN₂O·ClH

InChI: InChI=1S/C16H19ClN2O.ClH/c17-14-3-4-15(16-13(14)2-1-8-19-16)20-11-7-12-5-9-18-10-6-12;/h1-4,8,12,18H,5-7,9-11H2;1H

InChI key: InChIKey=XUYAUOFKPYXBHU-UHFFFAOYSA-N

SMILES: O(CCC1CCNCC1)C=2C3=C(C(Cl)=CC2)C=CC=N3.Cl

Synonyms:

• Quinoline, 5-chloro-8-[2-(4-piperidinyl)ethoxy]-, hydrochloride (1:1)