
CAS 1220028-19-2
:3-([1,1′-Biphenyl]-4-ylmethoxy)azetidine
Description:
3-([1,1′-Biphenyl]-4-ylmethoxy)azetidine is a chemical compound characterized by its azetidine ring, which is a four-membered saturated heterocycle containing one nitrogen atom. The presence of the biphenyl moiety, specifically a methoxy group attached to the fourth position of one of the biphenyl rings, contributes to its structural complexity and potential for various interactions. This compound may exhibit unique physical and chemical properties, such as solubility in organic solvents and potential reactivity due to the functional groups present. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as the azetidine ring is often found in biologically active compounds. Additionally, the biphenyl group may enhance the compound's lipophilicity, influencing its pharmacokinetic properties. Overall, 3-([1,1′-Biphenyl]-4-ylmethoxy)azetidine represents a class of compounds that could be of interest for further research in organic synthesis and drug development.
Formula:C16H17NO
InChI:InChI=1S/C16H17NO/c1-2-4-14(5-3-1)15-8-6-13(7-9-15)12-18-16-10-17-11-16/h1-9,16-17H,10-12H2
InChI key:InChIKey=AQJOBJUWGAEKRD-UHFFFAOYSA-N
SMILES:C(OC1CNC1)C2=CC=C(C=C2)C3=CC=CC=C3
Synonyms:- 3-([1,1′-Biphenyl]-4-ylmethoxy)azetidine
- Azetidine, 3-([1,1′-biphenyl]-4-ylmethoxy)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.