CAS 1220028-30-7

Quinoline, 5-chloro-8-(3-pyrrolidinyloxy)-, hydrochloride (1:1)

Description:

Quinoline, 5-chloro-8-(3-pyrrolidinyloxy)-, hydrochloride (1:1) is a chemical compound characterized by its quinoline backbone, which is a bicyclic structure containing a benzene ring fused to a pyridine ring. The presence of a chlorine atom at the 5-position and a pyrrolidinyloxy group at the 8-position contributes to its unique properties and potential biological activity. As a hydrochloride salt, it is typically more soluble in water, enhancing its utility in pharmaceutical applications. This compound may exhibit various pharmacological effects, potentially acting as a ligand or modulator in biological systems. Its structure suggests possible interactions with neurotransmitter systems, making it of interest in medicinal chemistry. Safety and handling precautions are essential, as with many chemical substances, due to potential toxicity or reactivity. Further studies would be necessary to fully elucidate its biological activity, mechanism of action, and therapeutic potential.

Formula: C₁₃H₁₃ClN₂O·ClH

InChI: InChI=1S/C13H13ClN2O.ClH/c14-11-3-4-12(17-9-5-7-15-8-9)13-10(11)2-1-6-16-13;/h1-4,6,9,15H,5,7-8H2;1H

InChI key: InChIKey=RZWJEHYZRVPUKK-UHFFFAOYSA-N

SMILES: O(C=1C2=C(C(Cl)=CC1)C=CC=N2)C3CCNC3.Cl

Synonyms:

• Quinoline, 5-chloro-8-(3-pyrrolidinyloxy)-, hydrochloride (1:1)