CAS 1220028-35-2

Piperidine, 3-[2-(cyclopropylmethoxy)ethyl]-, hydrochloride (1:1)

Description:

Piperidine, 3-[2-(cyclopropylmethoxy)ethyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine core, which is a six-membered saturated nitrogen-containing heterocycle. The presence of a cyclopropylmethoxyethyl substituent enhances its structural complexity and may influence its biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which is advantageous for various applications, including pharmaceutical formulations. The compound may exhibit properties such as basicity due to the nitrogen atom in the piperidine ring, allowing it to participate in protonation reactions. Its unique structure suggests potential interactions with biological targets, making it of interest in medicinal chemistry. However, specific pharmacological effects, toxicity, and stability would require further investigation through empirical studies. Overall, this compound exemplifies the diverse chemistry of piperidine derivatives and their potential utility in drug development.

Formula: C₁₁H₂₁NO·ClH

InChI: InChI=1S/C11H21NO.ClH/c1-2-10(8-12-6-1)5-7-13-9-11-3-4-11;/h10-12H,1-9H2;1H

InChI key: InChIKey=ZOGQVBJOMVAPCF-UHFFFAOYSA-N

SMILES: C(OCCC1CCCNC1)C2CC2.Cl

Synonyms:

• Piperidine, 3-[2-(cyclopropylmethoxy)ethyl]-, hydrochloride (1:1)