CAS 1220028-39-6

Methanone, (3-hydroxy-1-pyrrolidinyl)-3-piperidinyl-, hydrochloride (1:1)

Description:

Methanone, (3-hydroxy-1-pyrrolidinyl)-3-piperidinyl-, hydrochloride (1:1), identified by CAS number 1220028-39-6, is a chemical compound that belongs to a class of substances known for their psychoactive properties. This compound features a methanone functional group, which is characterized by a carbonyl group (C=O) bonded to a nitrogen-containing heterocycle, specifically a pyrrolidine and piperidine moiety. The presence of the hydroxyl group (-OH) contributes to its potential reactivity and solubility in polar solvents. As a hydrochloride salt, it is typically more stable and soluble in water compared to its free base form, which is advantageous for pharmaceutical applications. The compound may exhibit various biological activities, including potential effects on neurotransmitter systems, making it of interest in medicinal chemistry and pharmacology. However, detailed studies on its pharmacokinetics, toxicity, and therapeutic potential are essential for understanding its safety and efficacy in any applications.

Formula: C₁₀H₁₈N₂O₂·ClH

InChI: InChI=1S/C10H18N2O2.ClH/c13-9-3-5-12(7-9)10(14)8-2-1-4-11-6-8;/h8-9,11,13H,1-7H2;1H

InChI key: InChIKey=FHCAPDVSGPWMAH-UHFFFAOYSA-N

SMILES: C(=O)(N1CC(O)CC1)C2CCCNC2.Cl

Synonyms:

• Methanone, (3-hydroxy-1-pyrrolidinyl)-3-piperidinyl-, hydrochloride (1:1)