
CAS 1220028-41-0
:Piperidine, 2-[2-(2-propoxyethoxy)ethyl]-, hydrochloride (1:1)
Description:
Piperidine, 2-[2-(2-propoxyethoxy)ethyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine core, which is a six-membered saturated heterocyclic ring containing one nitrogen atom. This compound features a propoxyethoxy side chain, contributing to its solubility and potential biological activity. As a hydrochloride salt, it is typically more stable and soluble in water compared to its free base form, making it suitable for various applications, including pharmaceutical formulations. The presence of the piperidine moiety suggests potential interactions with biological systems, particularly in the context of neurotransmitter modulation. Its molecular structure may influence its pharmacokinetic properties, such as absorption, distribution, metabolism, and excretion. Additionally, the compound's characteristics, including melting point, boiling point, and specific reactivity, would depend on its purity and the conditions under which it is handled. Safety data should be consulted to understand its toxicity and handling precautions, as with any chemical substance.
Formula:C12H25NO2·ClH
InChI:InChI=1S/C12H25NO2.ClH/c1-2-8-14-10-11-15-9-6-12-5-3-4-7-13-12;/h12-13H,2-11H2,1H3;1H
InChI key:InChIKey=YZPOBVGEAGAXMK-UHFFFAOYSA-N
SMILES:C(COCCOCCC)C1CCCCN1.Cl
Synonyms:- Piperidine, 2-[2-(2-propoxyethoxy)ethyl]-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.