CAS 1220028-45-4

5-Bromo-N-(2-methoxyethyl)-3-methyl-2-pyridinamine

Description:

5-Bromo-N-(2-methoxyethyl)-3-methyl-2-pyridinamine is an organic compound characterized by its bromine substitution and pyridine ring structure. It features a bromine atom at the 5-position of the pyridine ring, which enhances its reactivity and potential applications in various chemical reactions. The presence of the N-(2-methoxyethyl) group contributes to its solubility and may influence its biological activity, making it of interest in medicinal chemistry. The 3-methyl group on the pyridine ring adds steric bulk, which can affect the compound's interaction with biological targets. This compound may exhibit properties such as moderate to high polarity due to the methoxyethyl substituent, and it could participate in hydrogen bonding due to the amine functional group. Its unique structure suggests potential applications in pharmaceuticals, agrochemicals, or as a building block in organic synthesis. As with many brominated compounds, it may also exhibit specific environmental and safety considerations that should be addressed during handling and application.

Formula: C₉H₁₃BrN₂O

InChI: InChI=1S/C9H13BrN2O/c1-7-5-8(10)6-12-9(7)11-3-4-13-2/h5-6H,3-4H2,1-2H3,(H,11,12)

InChI key: InChIKey=AALWTDXZGRCEJN-UHFFFAOYSA-N

SMILES: N(CCOC)C1=C(C)C=C(Br)C=N1

Synonyms:

• 5-Bromo-N-(2-methoxyethyl)-3-methyl-2-pyridinamine
• 2-Pyridinamine, 5-bromo-N-(2-methoxyethyl)-3-methyl-