CAS 1220028-48-7

3-[(4-Chloro-1-naphthalenyl)oxy]azetidine

Description:

3-[(4-Chloro-1-naphthalenyl)oxy]azetidine is a chemical compound characterized by its unique structure, which includes an azetidine ring and a 4-chloro-1-naphthyl ether moiety. The azetidine ring is a four-membered saturated heterocycle containing one nitrogen atom, contributing to the compound's potential biological activity. The presence of the 4-chloro substituent on the naphthalene ring enhances its lipophilicity and may influence its interaction with biological targets. This compound is likely to exhibit specific reactivity due to the electron-withdrawing nature of the chlorine atom, which can affect the overall electronic properties of the molecule. Additionally, the ether linkage introduces a degree of polarity, which may influence solubility in various solvents. While specific applications or biological activities may not be widely documented, compounds of this type are often explored in medicinal chemistry for their potential therapeutic effects. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.

Formula: C₁₃H₁₂ClNO

InChI: InChI=1S/C13H12ClNO/c14-12-5-6-13(16-9-7-15-8-9)11-4-2-1-3-10(11)12/h1-6,9,15H,7-8H2

InChI key: InChIKey=SLOCIMAFVSXUAC-UHFFFAOYSA-N

SMILES: O(C=1C2=C(C(Cl)=CC1)C=CC=C2)C3CNC3

Synonyms:

• 3-[(4-Chloro-1-naphthalenyl)oxy]azetidine
• Azetidine, 3-[(4-chloro-1-naphthalenyl)oxy]-