
CAS 1220028-49-8
:Piperidine, 3-[2-(2-phenoxyethoxy)ethyl]-, hydrochloride (1:1)
Description:
Piperidine, 3-[2-(2-phenoxyethoxy)ethyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated nitrogen-containing heterocycle. This compound features a phenoxyethoxy side chain, contributing to its potential biological activity and solubility properties. As a hydrochloride salt, it is typically more stable and soluble in water compared to its free base form, which is advantageous for various applications, including pharmaceutical formulations. The presence of the piperidine moiety suggests potential interactions with biological targets, making it of interest in medicinal chemistry. The compound may exhibit properties such as basicity due to the nitrogen atom in the piperidine ring, influencing its reactivity and interaction with other molecules. Additionally, the phenoxy group can enhance lipophilicity, potentially affecting its pharmacokinetics. Overall, this compound's unique structure and properties make it a subject of interest for research in drug development and related fields.
Formula:C15H23NO2·ClH
InChI:InChI=1S/C15H23NO2.ClH/c1-2-6-15(7-3-1)18-12-11-17-10-8-14-5-4-9-16-13-14;/h1-3,6-7,14,16H,4-5,8-13H2;1H
InChI key:InChIKey=VLYUMKBFXSLTQM-UHFFFAOYSA-N
SMILES:C(COCCOC1=CC=CC=C1)C2CCCNC2.Cl
Synonyms:- Piperidine, 3-[2-(2-phenoxyethoxy)ethyl]-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.