CAS 1220028-53-4

Methanone, [4-(2-hydroxyethyl)-1-piperazinyl]-4-piperidinyl-, hydrochloride (1:1)

Description:

Methanone, [4-(2-hydroxyethyl)-1-piperazinyl]-4-piperidinyl-, hydrochloride (1:1), identified by CAS number 1220028-53-4, is a chemical compound that features a complex structure incorporating piperazine and piperidine moieties. This substance is characterized by its hydrochloride salt form, which enhances its solubility in water, making it suitable for various applications, particularly in pharmaceutical formulations. The presence of the hydroxyethyl group contributes to its potential biological activity, possibly influencing its interaction with biological targets. As a piperazine derivative, it may exhibit properties relevant to central nervous system activity, and its structural features suggest potential use in medicinal chemistry, particularly in the development of therapeutic agents. The compound's stability, solubility, and reactivity can be influenced by the pH of the environment, and it may undergo various chemical reactions typical of amines and ketones. Overall, this compound represents a class of substances that are of interest in drug discovery and development due to their diverse pharmacological profiles.

Formula: C₁₂H₂₃N₃O₂·ClH

InChI: InChI=1S/C12H23N3O2.ClH/c16-10-9-14-5-7-15(8-6-14)12(17)11-1-3-13-4-2-11;/h11,13,16H,1-10H2;1H

InChI key: InChIKey=JTLVAKUBGSINAX-UHFFFAOYSA-N

SMILES: C(=O)(N1CCN(CCO)CC1)C2CCNCC2.Cl

Synonyms:

• Methanone, [4-(2-hydroxyethyl)-1-piperazinyl]-4-piperidinyl-, hydrochloride (1:1)