CymitQuimica logo

CAS 1220028-56-7

:

3-(2,3,5-Trimethylphenoxy)azetidine

Description:
3-(2,3,5-Trimethylphenoxy)azetidine is a chemical compound characterized by its azetidine ring, which is a four-membered saturated heterocyclic structure containing one nitrogen atom. The presence of the 2,3,5-trimethylphenoxy group indicates that the compound has a phenolic moiety with three methyl substituents on the aromatic ring, contributing to its hydrophobic characteristics and potentially influencing its reactivity and solubility. This compound may exhibit unique biological activities due to the combination of the azetidine structure and the bulky trimethylphenyl group, which can affect its interaction with biological targets. The molecular structure suggests that it could be of interest in medicinal chemistry, particularly in the development of pharmaceuticals or agrochemicals. Additionally, the presence of the nitrogen atom in the azetidine ring may impart basic properties, allowing for potential interactions with acidic environments. Overall, 3-(2,3,5-trimethylphenoxy)azetidine represents a complex organic molecule with potential applications in various fields, including drug development and material science.
Formula:C12H17NO
InChI:InChI=1S/C12H17NO/c1-8-4-9(2)10(3)12(5-8)14-11-6-13-7-11/h4-5,11,13H,6-7H2,1-3H3
InChI key:InChIKey=PZAPESQYMFEQMN-UHFFFAOYSA-N
SMILES:O(C1=C(C)C(C)=CC(C)=C1)C2CNC2
Synonyms:
  • 3-(2,3,5-Trimethylphenoxy)azetidine
  • Azetidine, 3-(2,3,5-trimethylphenoxy)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.