
CAS 1220028-59-0
:2-[[3-Amino-4-(methylsulfonyl)phenyl]methylamino]ethanol
Description:
2-[[3-Amino-4-(methylsulfonyl)phenyl]methylamino]ethanol, identified by its CAS number 1220028-59-0, is a chemical compound characterized by its complex structure that includes an amino group, a methylsulfonyl group, and an ethanol moiety. This compound typically exhibits properties associated with amines, such as basicity and the ability to form hydrogen bonds, which can influence its solubility in polar solvents like water. The presence of the methylsulfonyl group may enhance its stability and solubility, while also potentially contributing to its biological activity. The compound's structure suggests it may interact with biological systems, making it of interest in pharmaceutical research. Its specific applications and effects would depend on further studies, including its pharmacokinetics and mechanism of action. Overall, 2-[[3-Amino-4-(methylsulfonyl)phenyl]methylamino]ethanol represents a unique chemical entity with potential implications in medicinal chemistry and related fields.
Formula:C10H16N2O3S
InChI:InChI=1S/C10H16N2O3S/c1-12(5-6-13)8-3-4-10(9(11)7-8)16(2,14)15/h3-4,7,13H,5-6,11H2,1-2H3
InChI key:InChIKey=STYHLGMUKINAQM-UHFFFAOYSA-N
SMILES:N(CCO)(C)C1=CC(N)=C(S(C)(=O)=O)C=C1
Synonyms:- Ethanol, 2-[[3-amino-4-(methylsulfonyl)phenyl]methylamino]-
- 2-[[3-Amino-4-(methylsulfonyl)phenyl]methylamino]ethanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.